C17H21ClN4O2 — CID 94178191
(4S)-4-[4-(3-chloro-2-pyridinyl)piperazine-1-carbonyl]-1-cyclopropylpyrrolidin-2-one (PubChem CID 94178191) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is (4S)-4-[4-(3-chloro-2-pyridinyl)piperazine-1-carbonyl]-1-cyclopropylpyrrolidin-2-one.
| Compound Name | (4S)-4-[4-(3-chloro-2-pyridinyl)piperazine-1-carbonyl]-1-cyclopropylpyrrolidin-2-one |
|---|---|
| PubChem CID | 94178191 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (4S)-4-[4-(3-chloro-2-pyridinyl)piperazine-1-carbonyl]-1-cyclopropylpyrrolidin-2-one |
| SMILES | O=C([C@H]1CC(=O)N(C2CC2)C1)N1CCN(c2ncccc2Cl)CC1 |
| InChI | InChI=1S/C17H21ClN4O2/c18-14-2-1-5-19-16(14)20-6-8-21(9-7-20)17(24)12-10-15(23)22(11-12)13-3-4-13/h1-2,5,12-13H,3-4,6-11H2/t12-/m0/s1 |
| InChIKey | HROUMOMMIAHCFY-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |