C15H23N5OS — CID 94179657
1-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[(2R)-1-imidazol-1-ylpropan-2-yl]urea (PubChem CID 94179657) has the molecular formula C15H23N5OS and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[(2R)-1-imidazol-1-ylpropan-2-yl]urea.
| Compound Name | 1-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[(2R)-1-imidazol-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 94179657 |
| Molecular Formula | C15H23N5OS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[(2R)-1-imidazol-1-ylpropan-2-yl]urea |
| SMILES | C[C@H](Cn1ccnc1)NC(=O)NC[C@H](c1ccsc1)N(C)C |
| InChI | InChI=1S/C15H23N5OS/c1-12(9-20-6-5-16-11-20)18-15(21)17-8-14(19(2)3)13-4-7-22-10-13/h4-7,10-12,14H,8-9H2,1-3H3,(H2,17,18,21)/t12-,14-/m1/s1 |
| InChIKey | LXMRKXXXZJFOCU-TZMCWYRMSA-N |
| XLogP | 1.94 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |