C16H20N4O3 — CID 94179831
methyl N-[2-[(3S)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 94179831) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl N-[2-[(3S)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[(3S)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 94179831 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | methyl N-[2-[(3S)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)N1CCC[C@H](c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C16H20N4O3/c1-23-16(22)17-9-14(21)20-8-4-5-11(10-20)15-18-12-6-2-3-7-13(12)19-15/h2-3,6-7,11H,4-5,8-10H2,1H3,(H,17,22)(H,18,19)/t11-/m0/s1 |
| InChIKey | TURIGSMWATUVFG-NSHDSACASA-N |
| XLogP | 1.62 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |