C20H25N5O3 — CID 55824573
1-[2-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]-4-ethylpiperazine-2,3-dione (PubChem CID 55824573) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[2-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]-4-ethylpiperazine-2,3-dione.
| Compound Name | 1-[2-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]-4-ethylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 55824573 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-[2-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]-4-ethylpiperazine-2,3-dione |
| SMILES | CCN1CCN(CC(=O)N2CCCC(c3nc4ccccc4[nH]3)C2)C(=O)C1=O |
| InChI | InChI=1S/C20H25N5O3/c1-2-23-10-11-25(20(28)19(23)27)13-17(26)24-9-5-6-14(12-24)18-21-15-7-3-4-8-16(15)22-18/h3-4,7-8,14H,2,5-6,9-13H2,1H3,(H,21,22) |
| InChIKey | FCBKDDSJGXMOFJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|