C16H16F2N4O — CID 94182394
(1S)-1-(3,4-difluorophenyl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]ethanol (PubChem CID 94182394) has the molecular formula C16H16F2N4O and a molecular weight of 318.33 g/mol. Its IUPAC name is (1S)-1-(3,4-difluorophenyl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]ethanol.
| Compound Name | (1S)-1-(3,4-difluorophenyl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 94182394 |
| Molecular Formula | C16H16F2N4O |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (1S)-1-(3,4-difluorophenyl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]ethanol |
| SMILES | O[C@H](CNCCc1nnc2ccccn12)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16F2N4O/c17-12-5-4-11(9-13(12)18)14(23)10-19-7-6-16-21-20-15-3-1-2-8-22(15)16/h1-5,8-9,14,19,23H,6-7,10H2/t14-/m1/s1 |
| InChIKey | LKYWBEDYXYBIIJ-CQSZACIVSA-N |
| XLogP | 1.87 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|