C22H20N6O4 — CID 94199252
(3aR,6aS)-5-(4-ethoxyphenyl)-3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 94199252) has the molecular formula C22H20N6O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is (3aR,6aS)-5-(4-ethoxyphenyl)-3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aR,6aS)-5-(4-ethoxyphenyl)-3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 94199252 |
| Molecular Formula | C22H20N6O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (3aR,6aS)-5-(4-ethoxyphenyl)-3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | CCOc1ccc(N2C(=O)[C@H]3N=NN(Cc4nc(-c5ccccc5C)no4)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C22H20N6O4/c1-3-31-15-10-8-14(9-11-15)28-21(29)18-19(22(28)30)27(26-24-18)12-17-23-20(25-32-17)16-7-5-4-6-13(16)2/h4-11,18-19H,3,12H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | RAQZNTBLWZQURI-RBUKOAKNSA-N |
| XLogP | 2.94 |
| TPSA | 113.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|