C20H20N4O3 — CID 98208175
(3aS,6aR)-5-(4-ethoxyphenyl)-3-[(2-methylphenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 98208175) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is (3aS,6aR)-5-(4-ethoxyphenyl)-3-[(2-methylphenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | (3aS,6aR)-5-(4-ethoxyphenyl)-3-[(2-methylphenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 98208175 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (3aS,6aR)-5-(4-ethoxyphenyl)-3-[(2-methylphenyl)methyl]-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | CCOc1ccc(N2C(=O)[C@@H]3[C@@H](N=NN3Cc3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C20H20N4O3/c1-3-27-16-10-8-15(9-11-16)24-19(25)17-18(20(24)26)23(22-21-17)12-14-7-5-4-6-13(14)2/h4-11,17-18H,3,12H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | VIOVSNWSXDKUJK-MSOLQXFVSA-N |
| XLogP | 2.89 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|