C14H20N4O — CID 94199597
1-[(3S)-1-cyclopropylpyrrolidin-3-yl]-3-(3-methyl-2-pyridinyl)urea (PubChem CID 94199597) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-[(3S)-1-cyclopropylpyrrolidin-3-yl]-3-(3-methyl-2-pyridinyl)urea.
| Compound Name | 1-[(3S)-1-cyclopropylpyrrolidin-3-yl]-3-(3-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 94199597 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-[(3S)-1-cyclopropylpyrrolidin-3-yl]-3-(3-methyl-2-pyridinyl)urea |
| SMILES | Cc1cccnc1NC(=O)N[C@H]1CCN(C2CC2)C1 |
| InChI | InChI=1S/C14H20N4O/c1-10-3-2-7-15-13(10)17-14(19)16-11-6-8-18(9-11)12-4-5-12/h2-3,7,11-12H,4-6,8-9H2,1H3,(H2,15,16,17,19)/t11-/m0/s1 |
| InChIKey | KYELXJWOTKYGQE-NSHDSACASA-N |
| XLogP | 1.75 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |