C15H20BrN3O — CID 95628234
1-(5-bromo-2-methylphenyl)-3-[(3S)-1-cyclopropylpyrrolidin-3-yl]urea (PubChem CID 95628234) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-3-[(3S)-1-cyclopropylpyrrolidin-3-yl]urea.
| Compound Name | 1-(5-bromo-2-methylphenyl)-3-[(3S)-1-cyclopropylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 95628234 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-3-[(3S)-1-cyclopropylpyrrolidin-3-yl]urea |
| SMILES | Cc1ccc(Br)cc1NC(=O)N[C@H]1CCN(C2CC2)C1 |
| InChI | InChI=1S/C15H20BrN3O/c1-10-2-3-11(16)8-14(10)18-15(20)17-12-6-7-19(9-12)13-4-5-13/h2-3,8,12-13H,4-7,9H2,1H3,(H2,17,18,20)/t12-/m0/s1 |
| InChIKey | HFCDHQYPQDOBJK-LBPRGKRZSA-N |
| XLogP | 3.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |