C15H19BrN2O3 — CID 75447216
1-(5-bromo-2-methylphenyl)-3-(1,4-dioxaspiro[4.4]nonan-8-yl)urea (PubChem CID 75447216) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-3-(1,4-dioxaspiro[4.4]nonan-8-yl)urea.
| Compound Name | 1-(5-bromo-2-methylphenyl)-3-(1,4-dioxaspiro[4.4]nonan-8-yl)urea |
|---|---|
| PubChem CID | 75447216 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-3-(1,4-dioxaspiro[4.4]nonan-8-yl)urea |
| SMILES | Cc1ccc(Br)cc1NC(=O)NC1CCC2(C1)OCCO2 |
| InChI | InChI=1S/C15H19BrN2O3/c1-10-2-3-11(16)8-13(10)18-14(19)17-12-4-5-15(9-12)20-6-7-21-15/h2-3,8,12H,4-7,9H2,1H3,(H2,17,18,19) |
| InChIKey | KTLIOQLXIWRKTL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |