C17H24N2O3 — CID 143698513
1-(5-acetyl-2-methylphenyl)-3-(2,2-dimethyloxan-4-yl)urea (PubChem CID 143698513) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-(5-acetyl-2-methylphenyl)-3-(2,2-dimethyloxan-4-yl)urea.
| Compound Name | 1-(5-acetyl-2-methylphenyl)-3-(2,2-dimethyloxan-4-yl)urea |
|---|---|
| PubChem CID | 143698513 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-(5-acetyl-2-methylphenyl)-3-(2,2-dimethyloxan-4-yl)urea |
| SMILES | CC(=O)c1ccc(C)c(NC(=O)NC2CCOC(C)(C)C2)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-11-5-6-13(12(2)20)9-15(11)19-16(21)18-14-7-8-22-17(3,4)10-14/h5-6,9,14H,7-8,10H2,1-4H3,(H2,18,19,21) |
| InChIKey | PKHUFRMYRWQPTM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |