C20H25N3OS — CID 9420509
N-[4-[(4aR,8aS)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]phenyl]-2-methylpropanamide (PubChem CID 9420509) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is N-[4-[(4aR,8aS)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[(4aR,8aS)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 9420509 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[4-[(4aR,8aS)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]phenyl]-2-methylpropanamide |
| SMILES | CC1=C(c2ccc(NC(=O)C(C)C)cc2)N2C(=N[C@@H]3CCCC[C@@H]32)S1 |
| InChI | InChI=1S/C20H25N3OS/c1-12(2)19(24)21-15-10-8-14(9-11-15)18-13(3)25-20-22-16-6-4-5-7-17(16)23(18)20/h8-12,16-17H,4-7H2,1-3H3,(H,21,24)/t16-,17+/m1/s1 |
| InChIKey | UVDXQNHOWUBXAO-SJORKVTESA-N |
| XLogP | 4.70 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |