C12H16N2OS — CID 9420140
1-[(4aR,8aR)-1-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-2-yl]ethanone (PubChem CID 9420140) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 1-[(4aR,8aR)-1-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-2-yl]ethanone.
| Compound Name | 1-[(4aR,8aR)-1-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-2-yl]ethanone |
|---|---|
| PubChem CID | 9420140 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-[(4aR,8aR)-1-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-2-yl]ethanone |
| SMILES | CC(=O)C1=C(C)N2C(=N[C@@H]3CCCC[C@H]32)S1 |
| InChI | InChI=1S/C12H16N2OS/c1-7-11(8(2)15)16-12-13-9-5-3-4-6-10(9)14(7)12/h9-10H,3-6H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | SVSLPFQBTUYFDH-NXEZZACHSA-N |
| XLogP | 2.54 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |