C19H25N3O2S — CID 9420407
methyl 3-[3-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,5-dimethylpyrrol-1-yl]propanoate (PubChem CID 9420407) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is methyl 3-[3-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,5-dimethylpyrrol-1-yl]propanoate.
| Compound Name | methyl 3-[3-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,5-dimethylpyrrol-1-yl]propanoate |
|---|---|
| PubChem CID | 9420407 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | methyl 3-[3-[(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazol-1-yl]-2,5-dimethylpyrrol-1-yl]propanoate |
| SMILES | COC(=O)CCn1c(C)cc(C2=CSC3=N[C@@H]4CCCC[C@H]4N23)c1C |
| InChI | InChI=1S/C19H25N3O2S/c1-12-10-14(13(2)21(12)9-8-18(23)24-3)17-11-25-19-20-15-6-4-5-7-16(15)22(17)19/h10-11,15-16H,4-9H2,1-3H3/t15-,16-/m1/s1 |
| InChIKey | IZBTUVKEMCDIMH-HZPDHXFCSA-N |
| XLogP | 3.70 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |