C17H20N2OS — CID 9420303
(4aR,8aR)-1-(4-methoxyphenyl)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 9420303) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is (4aR,8aR)-1-(4-methoxyphenyl)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole.
| Compound Name | (4aR,8aR)-1-(4-methoxyphenyl)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 9420303 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (4aR,8aR)-1-(4-methoxyphenyl)-2-methyl-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
| SMILES | COc1ccc(C2=C(C)SC3=N[C@@H]4CCCC[C@H]4N32)cc1 |
| InChI | InChI=1S/C17H20N2OS/c1-11-16(12-7-9-13(20-2)10-8-12)19-15-6-4-3-5-14(15)18-17(19)21-11/h7-10,14-15H,3-6H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | QLEQTJZRBIQMCP-HUUCEWRRSA-N |
| XLogP | 4.11 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |