C17H20N2O2S — CID 9420327
(4aR,8aS)-1-(2,5-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 9420327) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is (4aR,8aS)-1-(2,5-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole.
| Compound Name | (4aR,8aS)-1-(2,5-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 9420327 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (4aR,8aS)-1-(2,5-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
| SMILES | COc1ccc(OC)c(C2=CSC3=N[C@@H]4CCCC[C@@H]4N23)c1 |
| InChI | InChI=1S/C17H20N2O2S/c1-20-11-7-8-16(21-2)12(9-11)15-10-22-17-18-13-5-3-4-6-14(13)19(15)17/h7-10,13-14H,3-6H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | XISSTBGIZOLRTJ-KGLIPLIRSA-N |
| XLogP | 3.73 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |