C15H17NOS2 — CID 94215253
3-cyclopropyl-N-[(1R)-1-(5-methylthiophen-2-yl)ethyl]thiophene-2-carboxamide (PubChem CID 94215253) has the molecular formula C15H17NOS2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 3-cyclopropyl-N-[(1R)-1-(5-methylthiophen-2-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 3-cyclopropyl-N-[(1R)-1-(5-methylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 94215253 |
| Molecular Formula | C15H17NOS2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-cyclopropyl-N-[(1R)-1-(5-methylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)c2sccc2C2CC2)s1 |
| InChI | InChI=1S/C15H17NOS2/c1-9-3-6-13(19-9)10(2)16-15(17)14-12(7-8-18-14)11-4-5-11/h3,6-8,10-11H,4-5H2,1-2H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | SSYKOQVAGGEOOJ-SNVBAGLBSA-N |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |