C11H13NO5S — CID 94231081
(E)-3-[2-methoxy-5-(methylsulfamoyl)phenyl]prop-2-enoic acid (PubChem CID 94231081) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is (E)-3-[2-methoxy-5-(methylsulfamoyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-methoxy-5-(methylsulfamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 94231081 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (E)-3-[2-methoxy-5-(methylsulfamoyl)phenyl]prop-2-enoic acid |
| SMILES | CNS(=O)(=O)c1ccc(OC)c(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C11H13NO5S/c1-12-18(15,16)9-4-5-10(17-2)8(7-9)3-6-11(13)14/h3-7,12H,1-2H3,(H,13,14)/b6-3+ |
| InChIKey | VKKQYYKRFMQLRI-ZZXKWVIFSA-N |
| XLogP | 0.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|