C14H21N3O2S2 — CID 9425478
1-tert-butyl-3-[(2-methoxy-4-methylsulfanylbenzoyl)amino]thiourea (PubChem CID 9425478) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2-methoxy-4-methylsulfanylbenzoyl)amino]thiourea.
| Compound Name | 1-tert-butyl-3-[(2-methoxy-4-methylsulfanylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 9425478 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-tert-butyl-3-[(2-methoxy-4-methylsulfanylbenzoyl)amino]thiourea |
| SMILES | COc1cc(SC)ccc1C(=O)NNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C14H21N3O2S2/c1-14(2,3)15-13(20)17-16-12(18)10-7-6-9(21-5)8-11(10)19-4/h6-8H,1-5H3,(H,16,18)(H2,15,17,20) |
| InChIKey | RGIGDEHMYDNBNR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|