C17H26N4O4S2 — CID 9425907
1-tert-butyl-3-[[4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoyl]amino]thiourea (PubChem CID 9425907) has the molecular formula C17H26N4O4S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-tert-butyl-3-[[4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 9425907 |
| Molecular Formula | C17H26N4O4S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-tert-butyl-3-[[4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoyl]amino]thiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)c1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C17H26N4O4S2/c1-17(2,3)19-16(26)21-20-15(22)12-6-8-14(9-7-12)27(23,24)18-11-13-5-4-10-25-13/h6-9,13,18H,4-5,10-11H2,1-3H3,(H,20,22)(H2,19,21,26)/t13-/m0/s1 |
| InChIKey | UTIWRCPVFPQGBW-ZDUSSCGKSA-N |
| XLogP | 1.05 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|