C15H11F5N2OS — CID 9426198
3-(methylsulfanylmethyl)-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide (PubChem CID 9426198) has the molecular formula C15H11F5N2OS and a molecular weight of 362.32 g/mol. Its IUPAC name is 3-(methylsulfanylmethyl)-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide.
| Compound Name | 3-(methylsulfanylmethyl)-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide |
|---|---|
| PubChem CID | 9426198 |
| Molecular Formula | C15H11F5N2OS |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 3-(methylsulfanylmethyl)-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide |
| SMILES | CSCc1cccc(C(=O)NNc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C15H11F5N2OS/c1-24-6-7-3-2-4-8(5-7)15(23)22-21-14-12(19)10(17)9(16)11(18)13(14)20/h2-5,21H,6H2,1H3,(H,22,23) |
| InChIKey | BXXPKLBUZMFZOB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|