C13H17FN4O3 — CID 9426932
3-(carbamoylamino)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylpropanamide (PubChem CID 9426932) has the molecular formula C13H17FN4O3 and a molecular weight of 296.30 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylpropanamide.
| Compound Name | 3-(carbamoylamino)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 9426932 |
| Molecular Formula | C13H17FN4O3 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-(carbamoylamino)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylpropanamide |
| SMILES | CN(CC(=O)Nc1ccc(F)cc1)C(=O)CCNC(N)=O |
| InChI | InChI=1S/C13H17FN4O3/c1-18(12(20)6-7-16-13(15)21)8-11(19)17-10-4-2-9(14)3-5-10/h2-5H,6-8H2,1H3,(H,17,19)(H3,15,16,21) |
| InChIKey | WPTCHSDXKGZPKD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |