C16H25NO2 — CID 94275984
(2,4,6-trimethylphenyl)methyl (2S)-2-amino-4-methylpentanoate (PubChem CID 94275984) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)methyl (2S)-2-amino-4-methylpentanoate.
| Compound Name | (2,4,6-trimethylphenyl)methyl (2S)-2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 94275984 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (2,4,6-trimethylphenyl)methyl (2S)-2-amino-4-methylpentanoate |
| SMILES | Cc1cc(C)c(COC(=O)[C@@H](N)CC(C)C)c(C)c1 |
| InChI | InChI=1S/C16H25NO2/c1-10(2)6-15(17)16(18)19-9-14-12(4)7-11(3)8-13(14)5/h7-8,10,15H,6,9,17H2,1-5H3/t15-/m0/s1 |
| InChIKey | RYVQUJPLLYZARI-HNNXBMFYSA-N |
| XLogP | 3.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |