C16H17ClO2 — CID 94285527
4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-1-methylbenzene (PubChem CID 94285527) has the molecular formula C16H17ClO2 and a molecular weight of 276.76 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-1-methylbenzene.
| Compound Name | 4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-1-methylbenzene |
|---|---|
| PubChem CID | 94285527 |
| Molecular Formula | C16H17ClO2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-(chloromethyl)-2-(3,4-dimethoxyphenyl)-1-methylbenzene |
| SMILES | COc1ccc(-c2cc(CCl)ccc2C)cc1OC |
| InChI | InChI=1S/C16H17ClO2/c1-11-4-5-12(10-17)8-14(11)13-6-7-15(18-2)16(9-13)19-3/h4-9H,10H2,1-3H3 |
| InChIKey | BFQXIINNUJYFTG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|