C15H22ClN3O — CID 9430826
(2S)-N-(2-chloro-3-pyridinyl)-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propanamide (PubChem CID 9430826) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is (2S)-N-(2-chloro-3-pyridinyl)-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propanamide.
| Compound Name | (2S)-N-(2-chloro-3-pyridinyl)-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 9430826 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (2S)-N-(2-chloro-3-pyridinyl)-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propanamide |
| SMILES | C[C@@H]1C[C@H](C)CN([C@@H](C)C(=O)Nc2cccnc2Cl)C1 |
| InChI | InChI=1S/C15H22ClN3O/c1-10-7-11(2)9-19(8-10)12(3)15(20)18-13-5-4-6-17-14(13)16/h4-6,10-12H,7-9H2,1-3H3,(H,18,20)/t10-,11+,12-/m0/s1 |
| InChIKey | GSYFBXKLXALVMU-TUAOUCFPSA-N |
| XLogP | 3.04 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|