C18H25FN2O3 — CID 94337716
1-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]-3-[[(3S)-oxan-3-yl]methyl]urea (PubChem CID 94337716) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]-3-[[(3S)-oxan-3-yl]methyl]urea.
| Compound Name | 1-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]-3-[[(3S)-oxan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 94337716 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]-3-[[(3S)-oxan-3-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCCOC1)N[C@H](c1ccc(F)cc1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H25FN2O3/c19-15-7-5-14(6-8-15)17(16-4-2-10-24-16)21-18(22)20-11-13-3-1-9-23-12-13/h5-8,13,16-17H,1-4,9-12H2,(H2,20,21,22)/t13-,16-,17+/m0/s1 |
| InChIKey | JQOMHWQQEFNTRB-RRQGHBQHSA-N |
| XLogP | 2.77 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |