C15H16FN3O2S — CID 94666979
1-[(R)-(4-fluorophenyl)-[(2R)-oxolan-2-yl]methyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 94666979) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-[(R)-(4-fluorophenyl)-[(2R)-oxolan-2-yl]methyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(R)-(4-fluorophenyl)-[(2R)-oxolan-2-yl]methyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 94666979 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-[(R)-(4-fluorophenyl)-[(2R)-oxolan-2-yl]methyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nccs1)N[C@H](c1ccc(F)cc1)[C@H]1CCCO1 |
| InChI | InChI=1S/C15H16FN3O2S/c16-11-5-3-10(4-6-11)13(12-2-1-8-21-12)18-14(20)19-15-17-7-9-22-15/h3-7,9,12-13H,1-2,8H2,(H2,17,18,19,20)/t12-,13-/m1/s1 |
| InChIKey | PEINLQPMLNBPGW-CHWSQXEVSA-N |
| XLogP | 3.32 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |