C22H27NO4 — CID 94345223
N-[(1S)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-4-phenylmethoxybutanamide (PubChem CID 94345223) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-4-phenylmethoxybutanamide.
| Compound Name | N-[(1S)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-4-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 94345223 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[(1S)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-4-phenylmethoxybutanamide |
| SMILES | C[C@H](NC(=O)CCCOCc1ccccc1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H27NO4/c1-17(19-10-11-20-21(15-19)27-14-6-13-26-20)23-22(24)9-5-12-25-16-18-7-3-2-4-8-18/h2-4,7-8,10-11,15,17H,5-6,9,12-14,16H2,1H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | RGFSRYJUBJSQJW-KRWDZBQOSA-N |
| XLogP | 4.02 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|