C20H30N2O4 — CID 55593927
N-[4-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethylamino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 55593927) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[4-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethylamino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethylamino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 55593927 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | N-[4-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethylamino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CC(NC(=O)CCCNC(=O)C(C)(C)C)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H30N2O4/c1-14(15-8-9-16-17(13-15)26-12-6-11-25-16)22-18(23)7-5-10-21-19(24)20(2,3)4/h8-9,13-14H,5-7,10-12H2,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | IUAVDNUACADULX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|