C14H25N5O3 — CID 9438137
1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1-butyl-3-ethylurea (PubChem CID 9438137) has the molecular formula C14H25N5O3 and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1-butyl-3-ethylurea.
| Compound Name | 1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1-butyl-3-ethylurea |
|---|---|
| PubChem CID | 9438137 |
| Molecular Formula | C14H25N5O3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1-butyl-3-ethylurea |
| SMILES | CCCCN(C(=O)NCC)c1c(N)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H25N5O3/c1-4-7-9-18(13(21)16-6-3)10-11(15)19(8-5-2)14(22)17-12(10)20/h4-9,15H2,1-3H3,(H,16,21)(H,17,20,22) |
| InChIKey | WKUFBCNZJIVSQD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |