C17H28N3O3+ — CID 9438141
1-(2-methoxyphenyl)-3-[[(2R)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]urea (PubChem CID 9438141) has the molecular formula C17H28N3O3+ and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[[(2R)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[[(2R)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]urea |
|---|---|
| PubChem CID | 9438141 |
| Molecular Formula | C17H28N3O3+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[[(2R)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]urea |
| SMILES | COc1ccccc1NC(=O)NC[C@@H]1C[NH+](CC(C)C)CCO1 |
| InChI | InChI=1S/C17H27N3O3/c1-13(2)11-20-8-9-23-14(12-20)10-18-17(21)19-15-6-4-5-7-16(15)22-3/h4-7,13-14H,8-12H2,1-3H3,(H2,18,19,21)/p+1/t14-/m1/s1 |
| InChIKey | VJBIBEPXACRITD-CQSZACIVSA-O |
| XLogP | 0.76 |
| TPSA | 64.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |