C17H20F2N2O3 — CID 94385224
(5R,6R)-3-[(2R)-2-(2,5-difluorophenyl)-2-hydroxyethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 94385224) has the molecular formula C17H20F2N2O3 and a molecular weight of 338.35 g/mol. Its IUPAC name is (5R,6R)-3-[(2R)-2-(2,5-difluorophenyl)-2-hydroxyethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6R)-3-[(2R)-2-(2,5-difluorophenyl)-2-hydroxyethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 94385224 |
| Molecular Formula | C17H20F2N2O3 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (5R,6R)-3-[(2R)-2-(2,5-difluorophenyl)-2-hydroxyethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(C[C@H](O)c1cc(F)ccc1F)C2=O |
| InChI | InChI=1S/C17H20F2N2O3/c1-10-4-2-3-7-17(10)15(23)21(16(24)20-17)9-14(22)12-8-11(18)5-6-13(12)19/h5-6,8,10,14,22H,2-4,7,9H2,1H3,(H,20,24)/t10-,14+,17-/m1/s1 |
| InChIKey | CPFNVCNDRFTJQM-OVWKYPIYSA-N |
| XLogP | 2.50 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|