C17H23N2O6S- — CID 9439318
(2R,3S)-3-hydroxy-2-[[4-(4-methylpiperidin-1-yl)sulfonylbenzoyl]amino]butanoate (PubChem CID 9439318) has the molecular formula C17H23N2O6S- and a molecular weight of 383.45 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-[[4-(4-methylpiperidin-1-yl)sulfonylbenzoyl]amino]butanoate.
| Compound Name | (2R,3S)-3-hydroxy-2-[[4-(4-methylpiperidin-1-yl)sulfonylbenzoyl]amino]butanoate |
|---|---|
| PubChem CID | 9439318 |
| Molecular Formula | C17H23N2O6S- |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-[[4-(4-methylpiperidin-1-yl)sulfonylbenzoyl]amino]butanoate |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)N[C@@H](C(=O)[O-])[C@H](C)O)cc2)CC1 |
| InChI | InChI=1S/C17H24N2O6S/c1-11-7-9-19(10-8-11)26(24,25)14-5-3-13(4-6-14)16(21)18-15(12(2)20)17(22)23/h3-6,11-12,15,20H,7-10H2,1-2H3,(H,18,21)(H,22,23)/p-1/t12-,15+/m0/s1 |
| InChIKey | ZSGGSRXRHLXGND-SWLSCSKDSA-M |
| XLogP | -0.66 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |