C20H19ClN4O4 — CID 9439811
N'-[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]-4-ethoxy-3-methoxybenzohydrazide (PubChem CID 9439811) has the molecular formula C20H19ClN4O4 and a molecular weight of 414.85 g/mol. Its IUPAC name is N'-[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]-4-ethoxy-3-methoxybenzohydrazide.
| Compound Name | N'-[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]-4-ethoxy-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 9439811 |
| Molecular Formula | C20H19ClN4O4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N'-[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]-4-ethoxy-3-methoxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)/C=C/c2c(Cl)nc3ccccn23)cc1OC |
| InChI | InChI=1S/C20H19ClN4O4/c1-3-29-15-9-7-13(12-16(15)28-2)20(27)24-23-18(26)10-8-14-19(21)22-17-6-4-5-11-25(14)17/h4-12H,3H2,1-2H3,(H,23,26)(H,24,27)/b10-8+ |
| InChIKey | LLHCYNSIAMCQMX-CSKARUKUSA-N |
| XLogP | 2.87 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|