C18H19FN4O — CID 94407142
2-[4-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile (PubChem CID 94407142) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[4-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[4-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 94407142 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[4-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CCN(C[C@@H](O)c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C18H19FN4O/c19-16-3-1-2-15(11-16)17(24)13-22-6-8-23(9-7-22)18-10-14(12-20)4-5-21-18/h1-5,10-11,17,24H,6-9,13H2/t17-/m1/s1 |
| InChIKey | GGIDRTQVOHTIND-QGZVFWFLSA-N |
| XLogP | 1.95 |
| TPSA | 63.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |