About 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile
2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile (PubChem CID 94407139) has the molecular formula C18H18F2N4O
and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile |
| PubChem CID | 94407139 |
| Molecular Formula | C18H18F2N4O |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CCN(C[C@H](O)c3ccc(F)cc3F)CC2)c1 |
| InChI | InChI=1S/C18H18F2N4O/c19-14-1-2-15(16(20)10-14)17(25)12-23-5-7-24(8-6-23)18-9-13(11-21)3-4-22-18/h1-4,9-10,17,25H,5-8,12H2/t17-/m0/s1 |
| InChIKey | KTUUPRUQMYZPRU-KRWDZBQOSA-N |
| XLogP | 2.09 |
| TPSA | 63.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile?
The IUPAC name of 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile (CID 94407139) is 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile.
What is the SMILES notation for 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile?
The canonical SMILES for 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile is N#Cc1ccnc(N2CCN(C[C@H](O)c3ccc(F)cc3F)CC2)c1.
What is the InChIKey of 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile?
The InChIKey is KTUUPRUQMYZPRU-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H18F2N4O/c19-14-1-2-15(16(20)10-14)17(25)12-23-5-7-24(8-6-23)18-9-13(11-21)3-4-22-18/h1-4,9-10,17,25H,5-8,12H2/t17-/m0/s1.
What are the key properties of 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile?
2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile has a molecular weight of 344.37 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]piperazin-1-yl]pyridine-4-carbonitrile is sourced from PubChem (CID 94407139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).