C21H24N2O5S — CID 9440930
[(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-phenylcyclopentane-1-carboxylate (PubChem CID 9440930) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-phenylcyclopentane-1-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 9440930 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-phenylcyclopentane-1-carboxylate |
| SMILES | C[C@H](OC(=O)C1(c2ccccc2)CCCC1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15(19(24)23-17-9-11-18(12-10-17)29(22,26)27)28-20(25)21(13-5-6-14-21)16-7-3-2-4-8-16/h2-4,7-12,15H,5-6,13-14H2,1H3,(H,23,24)(H2,22,26,27)/t15-/m0/s1 |
| InChIKey | UCEZBDBNRYVJPN-HNNXBMFYSA-N |
| XLogP | 2.72 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |