C21H23ClN2O5S — CID 16528445
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate (PubChem CID 16528445) has the molecular formula C21H23ClN2O5S and a molecular weight of 450.94 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 16528445 |
| Molecular Formula | C21H23ClN2O5S |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate |
| SMILES | CC(OC(=O)C1(c2ccc(Cl)cc2)CCCC1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H23ClN2O5S/c1-14(19(25)24-17-8-10-18(11-9-17)30(23,27)28)29-20(26)21(12-2-3-13-21)15-4-6-16(22)7-5-15/h4-11,14H,2-3,12-13H2,1H3,(H,24,25)(H2,23,27,28) |
| InChIKey | FVRUMQFIEPNAOR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |