C24H35N3O2 — CID 94420345
1-[2-[(2S)-2-cyclohexylpyrrolidin-1-yl]acetyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 94420345) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-[2-[(2S)-2-cyclohexylpyrrolidin-1-yl]acetyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(2S)-2-cyclohexylpyrrolidin-1-yl]acetyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 94420345 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 1-[2-[(2S)-2-cyclohexylpyrrolidin-1-yl]acetyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)CN2CCC[C@H]2C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H35N3O2/c28-23(18-27-15-7-12-22(27)19-8-3-1-4-9-19)26-16-13-20(14-17-26)24(29)25-21-10-5-2-6-11-21/h2,5-6,10-11,19-20,22H,1,3-4,7-9,12-18H2,(H,25,29)/t22-/m0/s1 |
| InChIKey | ZGDYZSJJNRTHSM-QFIPXVFZSA-N |
| XLogP | 3.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |