C22H22N4O3 — CID 26462621
1-[2-(2-oxoquinoxalin-1-yl)acetyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 26462621) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[2-(2-oxoquinoxalin-1-yl)acetyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(2-oxoquinoxalin-1-yl)acetyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26462621 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[2-(2-oxoquinoxalin-1-yl)acetyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)Cn2c(=O)cnc3ccccc32)CC1 |
| InChI | InChI=1S/C22H22N4O3/c27-20-14-23-18-8-4-5-9-19(18)26(20)15-21(28)25-12-10-16(11-13-25)22(29)24-17-6-2-1-3-7-17/h1-9,14,16H,10-13,15H2,(H,24,29) |
| InChIKey | CPJZNBUDTSJFEX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |