C20H19ClN4O4S — CID 27799698
1-[2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinoxalin-2-one (PubChem CID 27799698) has the molecular formula C20H19ClN4O4S and a molecular weight of 446.92 g/mol. Its IUPAC name is 1-[2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinoxalin-2-one.
| Compound Name | 1-[2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 27799698 |
| Molecular Formula | C20H19ClN4O4S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 1-[2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinoxalin-2-one |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H19ClN4O4S/c21-15-5-1-4-8-18(15)30(28,29)24-11-9-23(10-12-24)20(27)14-25-17-7-3-2-6-16(17)22-13-19(25)26/h1-8,13H,9-12,14H2 |
| InChIKey | CEVLFLBYPQGYQR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |