C19H18N4O4 — CID 32529717
1-[2-[4-(furan-3-carbonyl)piperazin-1-yl]-2-oxoethyl]quinoxalin-2-one (PubChem CID 32529717) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is 1-[2-[4-(furan-3-carbonyl)piperazin-1-yl]-2-oxoethyl]quinoxalin-2-one.
| Compound Name | 1-[2-[4-(furan-3-carbonyl)piperazin-1-yl]-2-oxoethyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 32529717 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[2-[4-(furan-3-carbonyl)piperazin-1-yl]-2-oxoethyl]quinoxalin-2-one |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)N1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C19H18N4O4/c24-17-11-20-15-3-1-2-4-16(15)23(17)12-18(25)21-6-8-22(9-7-21)19(26)14-5-10-27-13-14/h1-5,10-11,13H,6-9,12H2 |
| InChIKey | CUBRLQZORCUYOO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |