C8H18N2 — CID 94424015
(2S)-1-N-cyclobutylbutane-1,2-diamine (PubChem CID 94424015) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is (2S)-1-N-cyclobutylbutane-1,2-diamine.
| Compound Name | (2S)-1-N-cyclobutylbutane-1,2-diamine |
|---|---|
| PubChem CID | 94424015 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (2S)-1-N-cyclobutylbutane-1,2-diamine |
| SMILES | CC[C@H](N)CNC1CCC1 |
| InChI | InChI=1S/C8H18N2/c1-2-7(9)6-10-8-4-3-5-8/h7-8,10H,2-6,9H2,1H3/t7-/m0/s1 |
| InChIKey | BPDSJDNWXLCNCO-ZETCQYMHSA-N |
| XLogP | 0.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |