C16H34N2 — CID 83958083
1-N-cyclododecylbutane-1,2-diamine (PubChem CID 83958083) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 1-N-cyclododecylbutane-1,2-diamine.
| Compound Name | 1-N-cyclododecylbutane-1,2-diamine |
|---|---|
| PubChem CID | 83958083 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 1-N-cyclododecylbutane-1,2-diamine |
| SMILES | CCC(N)CNC1CCCCCCCCCCC1 |
| InChI | InChI=1S/C16H34N2/c1-2-15(17)14-18-16-12-10-8-6-4-3-5-7-9-11-13-16/h15-16,18H,2-14,17H2,1H3 |
| InChIKey | OGKWUNRZEDMGLC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |