C15H24N2 — CID 61149481
1-N-cyclohexyl-3-phenylpropane-1,2-diamine (PubChem CID 61149481) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-N-cyclohexyl-3-phenylpropane-1,2-diamine.
| Compound Name | 1-N-cyclohexyl-3-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 61149481 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-N-cyclohexyl-3-phenylpropane-1,2-diamine |
| SMILES | NC(CNC1CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C15H24N2/c16-14(11-13-7-3-1-4-8-13)12-17-15-9-5-2-6-10-15/h1,3-4,7-8,14-15,17H,2,5-6,9-12,16H2 |
| InChIKey | PFIRQGLDWKVSFE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |