C13H20N2 — CID 129054273
(3S)-1-N-cyclopropyl-4-phenylbutane-1,3-diamine (PubChem CID 129054273) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (3S)-1-N-cyclopropyl-4-phenylbutane-1,3-diamine.
| Compound Name | (3S)-1-N-cyclopropyl-4-phenylbutane-1,3-diamine |
|---|---|
| PubChem CID | 129054273 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (3S)-1-N-cyclopropyl-4-phenylbutane-1,3-diamine |
| SMILES | N[C@H](CCNC1CC1)Cc1ccccc1 |
| InChI | InChI=1S/C13H20N2/c14-12(8-9-15-13-6-7-13)10-11-4-2-1-3-5-11/h1-5,12-13,15H,6-10,14H2/t12-/m1/s1 |
| InChIKey | LSCANPKUXBFYFM-GFCCVEGCSA-N |
| XLogP | 1.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |