C12H13Cl2N3O2 — CID 944506
N-(3,4-dichlorophenyl)-2-[(2R)-3-oxopiperazin-2-yl]acetamide (PubChem CID 944506) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[(2R)-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[(2R)-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 944506 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[(2R)-3-oxopiperazin-2-yl]acetamide |
| SMILES | O=C(C[C@H]1NCCNC1=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N3O2/c13-8-2-1-7(5-9(8)14)17-11(18)6-10-12(19)16-4-3-15-10/h1-2,5,10,15H,3-4,6H2,(H,16,19)(H,17,18)/t10-/m1/s1 |
| InChIKey | JPTBGIHCKDTFGU-SNVBAGLBSA-N |
| XLogP | 1.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |