C13H15F2N3O3 — CID 2987992
N-[4-(difluoromethoxy)phenyl]-2-(3-oxopiperazin-2-yl)acetamide (PubChem CID 2987992) has the molecular formula C13H15F2N3O3 and a molecular weight of 299.28 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-(3-oxopiperazin-2-yl)acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-(3-oxopiperazin-2-yl)acetamide |
|---|---|
| PubChem CID | 2987992 |
| Molecular Formula | C13H15F2N3O3 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-(3-oxopiperazin-2-yl)acetamide |
| SMILES | O=C(CC1NCCNC1=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H15F2N3O3/c14-13(15)21-9-3-1-8(2-4-9)18-11(19)7-10-12(20)17-6-5-16-10/h1-4,10,13,16H,5-7H2,(H,17,20)(H,18,19) |
| InChIKey | AIFVSVPCLDHRHG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |