C13H16F2N3O3+ — CID 7273609
N-[4-(difluoromethoxy)phenyl]-2-[(2R)-3-oxopiperazin-1-ium-2-yl]acetamide (PubChem CID 7273609) has the molecular formula C13H16F2N3O3+ and a molecular weight of 300.29 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[(2R)-3-oxopiperazin-1-ium-2-yl]acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[(2R)-3-oxopiperazin-1-ium-2-yl]acetamide |
|---|---|
| PubChem CID | 7273609 |
| Molecular Formula | C13H16F2N3O3+ |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[(2R)-3-oxopiperazin-1-ium-2-yl]acetamide |
| SMILES | O=C(C[C@H]1[NH2+]CCNC1=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H15F2N3O3/c14-13(15)21-9-3-1-8(2-4-9)18-11(19)7-10-12(20)17-6-5-16-10/h1-4,10,13,16H,5-7H2,(H,17,20)(H,18,19)/p+1/t10-/m1/s1 |
| InChIKey | AIFVSVPCLDHRHG-SNVBAGLBSA-O |
| XLogP | -0.32 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |