C12H15FN3O2+ — CID 6956092
N-(4-fluorophenyl)-2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetamide (PubChem CID 6956092) has the molecular formula C12H15FN3O2+ and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetamide |
|---|---|
| PubChem CID | 6956092 |
| Molecular Formula | C12H15FN3O2+ |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetamide |
| SMILES | O=C(C[C@@H]1[NH2+]CCNC1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H14FN3O2/c13-8-1-3-9(4-2-8)16-11(17)7-10-12(18)15-6-5-14-10/h1-4,10,14H,5-7H2,(H,15,18)(H,16,17)/p+1/t10-/m0/s1 |
| InChIKey | FUGCPGSWUPZYDI-JTQLQIEISA-O |
| XLogP | -0.78 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |